Organonitrogen Compounds
eMolecules 1206228-83-2 | Methyl 3-methylpiperidine-3-carboxylate | Combi-Blocks | MFCD11045408 | 157.213 | C8H15NO2 | 96.000 | COC(=O)C1(C)CCCNC1 | 5g | 528673298
Methyl 3-methylpiperidine-3-carboxylate | Combi-Blocks | 1206228-83-2 | MFCD11045408 | 157.213 | C8H15NO2 | 96.000 | COC(=O)C1(C)CCCNC1 | 5g | 528673298
eMolecules 166330-10-5 | Bis(2-diphenylphosphinophenyl)ether | Combi-Blocks | MFCD00233863 | 538.567 | C36H28OP2 | 98.000 | O(c1ccccc1P(c1ccccc1)c1ccccc1)c1ccccc1P(c1ccccc1)c1ccccc1 | 100g | 257647933
Bis(2-diphenylphosphinophenyl)ether | Combi-Blocks | 166330-10-5 | MFCD00233863 | 538.567 | C36H28OP2 | 98.000 | O(c1ccccc1P(c1ccccc1)c1ccccc1)c1ccccc1P(c1ccccc1)c1ccccc1 | 100g | 257647933
Apexbio Technology LLC Diclofenac Diethylamine 78213-16-8 5g
Diclofenac diethylamine (CAS 78213-16-8) is a small molecule classified as a nonsteroidal anti-inflammatory drug (NSAID) It exerts its pharmacological effects primarily through the inhibition of cyclooxygenase (COX) enzymes resulting in reduced synthesis of prostaglandins involved in inflammation and pain signaling Diclofenac diethylamine is frequently utilized in preclinical and clinical research to investigate inflammatory pathways and nociception as well as to model therapeutic interventions for musculoskeletal and rheumatological disorders Its well-characterized mechanism supports its use for studies focusing on analgesic and anti-inflammatory pharmacodynamics
Aobchem 1-Adamantyl isocyanide | ≥95% | CAS 22110-53-8 | C11H15N | 250mg
1-Adamantyl isocyanide | ≥95% | CAS 22110-53-8 | C11H15N | 250mg
Aobchem Diisopropylamine 2 2 2-trifluoroacetate | 95% | CAS 64836-67-5 | C8H16F3NO2 | 25g
Diisopropylamine 2 2 2-trifluoroacetate | 95% | CAS 64836-67-5 | C8H16F3NO2 | 25g
eMolecules 1594-58-7 | N-Hydroxynicotinimidamide | MFCD08706032 | 5g
Medchem Express | MethylCBI-azaindole-benzamide-MOM-Boc-ethylenediamine-D | 5mg | 719836098 | HY-145488 | 2222445-87-4 | 859.370 | C44H51ClN6O10
If you are unable to find the chemical you are looking for, make sure you are logged into your fishersci.com account and click on the following link:
eMolecules Building Block Tool<|a>
eMolecules 4431-83-8 | Bis(2-methoxyethoxy)methane | Oakwood Chemical | MFCD00043945 | 164.201 | C7H16O4 | 97.000 | COCCOCOCCOC | 5g | 851146928
Bis(2-methoxyethoxy)methane | Oakwood Chemical | 4431-83-8 | MFCD00043945 | 164.201 | C7H16O4 | 97.000 | COCCOCOCCOC | 5g | 851146928
![eMolecules 1965314-73-1 | (S)-ISOINDOLINE-1-CARBOXYLIC ACID HCL | AstaTech | MFCD28098115 | 199.630 | C9H10ClNO2 | 95.000 | Cl.OC(=O)[C@H]1NCc2ccccc12 | 1g | 448262759](https://assets.fishersci.com/TFS-Assets/CCG/product-images/502181579.JPG-250.jpg)
eMolecules 1965314-73-1 | (S)-ISOINDOLINE-1-CARBOXYLIC ACID HCL | AstaTech | MFCD28098115 | 199.630 | C9H10ClNO2 | 95.000 | Cl.OC(=O)[C@H]1NCc2ccccc12 | 1g | 448262759
(S)-ISOINDOLINE-1-CARBOXYLIC ACID HCL | AstaTech | 1965314-73-1 | MFCD28098115 | 199.630 | C9H10ClNO2 | 95.000 | Cl.OC(=O)[C@H]1NCc2ccccc12 | 1g | 448262759
eMolecules 52568-28-2 | 2-(2-PYRIDYL)-2-PROPYLAMINE | AstaTech | MFCD08729302 | 136.198 | C8H12N2 | 95.000 | CC(C)(N)c1ccccn1 | 1g | 386413440
2-(2-PYRIDYL)-2-PROPYLAMINE | AstaTech | 52568-28-2 | MFCD08729302 | 136.198 | C8H12N2 | 95.000 | CC(C)(N)c1ccccn1 | 1g | 386413440